![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Advanced Critical Hi..> | 2016-10-21 19:23 | 58K | |
| Bazaar of the Bizarr..> | 2016-10-21 19:23 | 158K | |
| Boats.pdf | 2016-10-21 19:03 | 50K | |
| Border Town Burning/ | 2023-12-14 11:39 | - | |
| Captives.pdf | 2016-10-21 19:23 | 58K | |
| Catacombs Below Mord..> | 2016-10-21 19:23 | 103K | |
| Chariot Races v2.01.pdf | 2016-10-21 19:23 | 70K | |
| Combat System Altern..> | 2016-10-21 19:23 | 60K | |
| Combat System Altern..> | 2016-10-21 19:23 | 90K | |
| Coreheim/ | 2023-12-14 11:39 | - | |
| Death Stalks the Cit..> | 2016-10-21 19:23 | 102K | |
| Dramatis Personae/ | 2023-12-14 11:39 | - | |
| Drugs.pdf | 2016-10-21 19:23 | 64K | |
| Duels in Mordheim v2..> | 2016-10-21 19:23 | 61K | |
| Encampments.pdf | 2016-10-21 19:23 | 96K | |
| Gentlemen's Mordheim..> | 2016-10-21 19:23 | 748K | |
| Hellpit Crater.pdf | 2016-10-21 19:23 | 79K | |
| Hired Swords/ | 2023-12-14 11:39 | - | |
| Insanity (At the Mou..> | 2016-10-21 19:23 | 92K | |
| League Rules Example..> | 2016-10-21 19:03 | 44K | |
| Let the Damned Burn!..> | 2016-10-21 19:23 | 85K | |
| Limiting Wizards.pdf | 2016-10-21 19:23 | 70K | |
| Lords of the Night.pdf | 2016-10-21 19:23 | 70K | |
| Magic System Alterna..> | 2016-10-21 19:23 | 134K | |
| Making an Alternativ..> | 2016-10-21 19:23 | 114K | |
| Malal, the Renegade ..> | 2016-10-21 19:03 | 58K | |
| Mordheim - Rulebook ..> | 2020-05-26 21:54 | 140M | |
| Musicians.pdf | 2016-10-21 19:23 | 59K | |
| Nemesis Crown.pdf | 2016-10-21 19:26 | 11M | |
| Night Fighting (Fear..> | 2016-10-21 19:23 | 95K | |
| Optional Skills List..> | 2016-10-21 19:03 | 49K | |
| Order of Assassins, ..> | 2016-10-21 19:23 | 84K | |
| Outlaws.pdf | 2016-10-21 19:03 | 58K | |
| Parry Alternative Ru..> | 2016-10-21 19:23 | 359K | |
| Pitfighting v2.01.pdf | 2016-10-21 19:03 | 40K | |
| Psychology Alternati..> | 2016-10-21 19:23 | 67K | |
| Random Rumours.pdf | 2016-10-21 19:03 | 25K | |
| Rules - Dog Fights.pdf | 2016-10-21 19:23 | 526K | |
| Sartosa/ | 2023-12-14 11:39 | - | |
| Seasonal Weather.pdf | 2016-10-21 19:23 | 97K | |
| Sewer Fighting.pdf | 2016-10-21 19:23 | 109K | |
| Shadow Walker.pdf | 2016-10-21 19:03 | 47K | |
| Shadowlord (Lord of ..> | 2016-10-21 19:03 | 46K | |
| Tunnels.pdf | 2016-10-21 19:03 | 53K | |
| Turn Sequence Altern..> | 2016-10-21 19:03 | 40K | |
| Undead Additional Un..> | 2016-10-21 19:23 | 78K | |
| Voluntarily Routing.pdf | 2016-10-21 19:03 | 44K | |
| Warhammer AHOY!/ | 2023-12-14 11:39 | - | |
| Weather Chart.pdf | 2016-10-21 19:23 | 69K | |
| Wells.pdf | 2016-10-21 19:03 | 23K | |
| Wyrdstone Reaction C..> | 2016-10-21 19:03 | 43K | |