![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Beach Bowl/ | 2023-08-25 23:48 | - | |
| Bloodbowl 7/ | 2023-08-25 23:48 | - | |
| Playbooks/ | 2023-08-25 23:48 | - | |
| Street Bowl/ | 2023-08-25 23:48 | - | |
| Vault Rules/ | 2023-08-25 23:48 | - | |
| experimental teams2.doc | 2023-08-25 23:48 | 44K | |
| Star Player Competit..> | 2023-08-25 23:48 | 60K | |
| Simultaneous Turns.pdf | 2023-08-25 23:48 | 78K | |
| Bridge Bowl Manual E..> | 2023-08-25 23:48 | 85K | |
| Penalties Rules - Ki..> | 2023-08-25 23:48 | 93K | |
| Blood Bowl Stars.xls | 2023-08-25 23:48 | 104K | |
| experimental teams.doc | 2023-08-25 23:48 | 125K | |
| Vendetta.pdf | 2023-08-25 23:48 | 125K | |
| Another Round of Kic..> | 2023-08-25 23:48 | 138K | |
| Mercenaries.pdf | 2023-08-25 23:48 | 139K | |
| Weather Revisited.pdf | 2023-08-25 23:48 | 160K | |
| Lose-o-graph.pdf | 2023-08-25 23:48 | 164K | |
| Referees Rules - Sta..> | 2023-08-25 23:48 | 215K | |
| Beast Bowl - Beastme..> | 2023-08-25 23:48 | 250K | |
| The Dark-Side Slide.pdf | 2023-08-25 23:48 | 264K | |
| OLBBL Allowed Races.doc | 2023-08-25 23:48 | 268K | |
| bridgebowl pitch.jpg | 2023-08-25 23:48 | 318K | |
| Death Bowl.pdf | 2023-08-25 23:48 | 371K | |
| Kappa & Brawler Star..> | 2023-08-25 23:48 | 446K | |
| College's of Magic C..> | 2023-08-25 23:48 | 456K | |
| Forgotten Chaos Team..> | 2023-08-25 23:48 | 634K | |
| Brutal Game.pdf | 2023-08-25 23:48 | 750K | |
| Blood Bowl Aussie Ru..> | 2023-08-25 23:48 | 792K | |
| bridgebowl pitch2.jpg | 2023-08-25 23:48 | 1.1M | |
| Secret weapons in Bl..> | 2023-08-25 23:48 | 1.3M | |
| Putting The Boot In ..> | 2023-08-25 23:48 | 1.3M | |
| Generic System marke..> | 2023-08-25 23:48 | 1.4M | |
| A League of Their Ow..> | 2023-08-25 23:48 | 1.9M | |
| Inducements.pdf | 2023-08-25 23:48 | 2.5M | |
| Snotling teams - Eve..> | 2023-08-25 23:48 | 2.9M | |