![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 06 The Last Day.epub | 2023-08-26 01:09 | 1.4M | |
| 09 In the Belly of t..> | 2023-08-26 01:09 | 1.2M | |
| 11 The Voice in the ..> | 2023-08-26 01:09 | 1.4M | |
| 08 Commencing Hostil..> | 2023-08-26 01:09 | 1.2M | |
| 03 Desperate Measure..> | 2023-08-26 01:09 | 1.2M | |
| 15 The Threshold of ..> | 2023-08-26 01:09 | 1.2M | |
| 04 Amidst The Flames..> | 2023-08-26 01:09 | 1.3M | |
| 13 Aqua Sanctus.epub | 2023-08-26 01:09 | 1.3M | |
| 05 The Three-Armed G..> | 2023-08-26 01:09 | 1.3M | |
| 01 To Kill a Dark Ki..> | 2023-08-26 01:09 | 1.2M | |
| 02 Tainted Cargo.epub | 2023-08-26 01:09 | 1.4M | |
| 12 Kill Shot.epub | 2023-08-26 01:09 | 1.3M | |
| 10 The Messenger.epub | 2023-08-26 01:09 | 1.1M | |
| 07 Dark Uprising.epub | 2023-08-26 01:09 | 1.3M | |
| 14 Beneath the Surfa..> | 2023-08-26 01:09 | 1.5M | |